Skip to content
This article is for educational purposes. We encourage you to verify with official sources.

Tu ever walked past a market stall in Freetown and caught that sweet, fruity smell wafting from a perfume seller's table? Or maybe you noticed how your favorite body splash smells exactly like ripe bananas from Njala? That's not magic—it's chemistry happening in a flask. The secret is in a group of compounds called esters, and today you're going to crack the code behind why your perfume smells like the sweetest fruit from Sierra Leone's farms. From the chemistry labs of Fourah Bay College to the sachet sellers at Kissi Road, esters are everywhere. By the end of this annales, you'll not only understand the science but also solve problems that could appear in your WASSCE Chemistry exam. Grab your calculator and let's go!

Exercice 1: Identifying the Ester Functional Group (4 points)

Functional groupsEster structure

Below are three organic compounds. Only one contains the ester functional group responsible for banana scent. Identify it and explain your choice.

  • Compound A: CH₃COOH
  • Compound B: CH₃COOCH₂CH₂CH(CH₃)₂
  • Compound C: CH₃CH₂OH
  1. Which compound is the ester? Give two reasons for your choice.
  2. Write the IUPAC name of the ester compound.
  3. Draw the structural formula of this ester showing all bonds.
Full solution
  1. Identify functional groups — Recall that esters have the general formula RCOOR' where R and R' are alkyl or aryl groups. The functional group contains a carbonyl group (C=O) adjacent to an ether-like oxygen (C-O-C).
    RC(=O)OR
  2. Analyze each compound — Compound A is ethanoic acid (acetic acid) with formula CH₃COOH - it has a carboxyl group (-COOH), not an ester group. Compound C is ethanol (CH₃CH₂OH), an alcohol with hydroxyl group (-OH). Compound B has the characteristic -COO- group between two carbon chains.
  3. Name the ester — For ester naming, identify the alcohol part (alkyl group attached to oxygen) and acid part (alkyl group attached to carbonyl). The alcohol part here is 3-methylbutyl (from isoamyl alcohol), and the acid part is ethanoate (from ethanoic acid).
    3-methylbutyl ethanoate

CH3C(=O)OCH2CH2CH(CH3)CH3

→ Compound B is the ester. Its IUPAC name is 3-methylbutyl ethanoate. Structural formula: CH₃-C(=O)-O-CH₂-CH₂-CH(CH₃)-CH₃

Grading rubric

Correct identification of ester compound1 pts
Two valid reasons for choice (functional group + structure)1 pts
Correct IUPAC name of ester1 pts
Correct structural formula with all bonds shown1 pts

Exercice 2: Writing the Esterification Reaction (5 points)

Esterification reactionsCondensation reactionsBalancing equations

Isoamyl acetate is the ester responsible for banana scent. It forms when isoamyl alcohol reacts with acetic acid. Write the balanced chemical equation for this reaction and name all products.

  • Isoamyl alcohol: C₅H₁₁OH (3-methylbutan-1-ol)
  • Acetic acid: CH₃COOH
  1. Write the word equation for the reaction.
  2. Write the balanced chemical equation using molecular formulas.
  3. Name the ester product formed.
  4. What type of reaction is this? Explain why it's called a condensation reaction.
Full solution
  1. Word equation — Alcohol + carboxylic acid → ester + water. This is the general pattern for esterification.
  2. Molecular formulas — Isoamyl alcohol is C₅H₁₂O, acetic acid is C₂H₄O₂. The ester isoamyl acetate is C₇H₁₄O₂. Water is H₂O.
    C5H12O+C2H4O2C7H14O2+H2O
  3. Name products — The ester is isoamyl acetate (3-methylbutyl ethanoate). Water is obviously water.
  4. Reaction type — This is a condensation reaction because two molecules combine to form one larger molecule while releasing a smaller molecule (water). Each esterification removes one H₂O molecule.

C5H11OH+CH3COOHC7H14O2+H2O

→ C₅H₁₁OH + CH₃COOH → C₇H₁₄O₂ + H₂O. The ester is isoamyl acetate (3-methylbutyl ethanoate). It's a condensation reaction because water is eliminated during the formation of the ester bond.

Grading rubric

Correct word equation1 pts
Correct balanced chemical equation2 pts
Correct name of ester product1 pts
Correct identification of condensation reaction with explanation1 pts

Exercice 3: Calculating Theoretical Yield in Local Context (6 points)

StoichiometryMole calculationsPercentage yield concepts

A local perfume manufacturer in Freetown wants to produce banana-scented ester for sachets. They react 150 mL of isoamyl alcohol (density = 0.81 g/mL, molar mass = 88 g/mol) with excess acetic acid. Calculate the theoretical yield of isoamyl acetate in grams.

  • Volume of isoamyl alcohol = 150 mL
  • Density of isoamyl alcohol = 0.81 g/mL
  • Molar mass of isoamyl alcohol = 88 g/mol
  • Molar mass of isoamyl acetate = 130 g/mol
  • Reaction: C₅H₁₁OH + CH₃COOH → C₇H₁₄O₂ + H₂O
  1. Calculate the mass of isoamyl alcohol used.
  2. Determine the number of moles of isoamyl alcohol.
  3. Using stoichiometry, find the theoretical moles of ester formed.
  4. Calculate the theoretical mass of isoamyl acetate in grams.
Full solution
  1. Calculate mass of alcohol — Use density to convert volume to mass: mass = volume × density.
    m=150 mL×0.81 g/mL=121.5 g
  2. Convert to moles — Use molar mass to find moles: moles = mass / molar mass.
    n=121.5 g88 g/mol=1.38 mol
  3. Stoichiometric ratio — From the balanced equation, 1 mole of alcohol produces 1 mole of ester. So moles of ester = moles of alcohol = 1.38 mol.
    nester=1.38 mol
  4. Calculate ester mass — Convert moles of ester to mass using its molar mass.
    mester=1.38 mol×130 g/mol=179.4 g

179.4 g

→ The theoretical yield is 179.4 grams of isoamyl acetate.

Grading rubric

Correct calculation of mass from volume and density1 pts
Correct mole calculation for isoamyl alcohol1 pts
Correct stoichiometric conversion to ester moles1 pts
Correct final mass calculation of ester2 pts
Proper units and significant figures1 pts

Exercice 4: Real-World Application - Market Analysis (5 points)

Ester applicationsLocal industry analysisCost-benefit thinking

At the Kissi Road market in Freetown, a sachet seller claims his banana-scented sachets contain 'pure natural banana extract.' As a chemistry student, you suspect it's synthetic isoamyl acetate. Explain how ester chemistry supports your suspicion and describe what you would look for on the label.

  1. Why would synthetic isoamyl acetate be used instead of natural banana extract?
  2. What chemical evidence would you expect to find if the scent is from synthetic ester?
  3. How could you test this claim using simple chemical tests available in a school lab?
  4. What local economic benefit might synthetic production offer over importing natural extracts?
Full solution
  1. Advantages of synthetic — Synthetic isoamyl acetate is cheaper to produce at scale, has consistent quality, doesn't depend on banana harvest seasons, and can be precisely controlled for strength and purity. Natural extracts vary in composition and are more expensive.
  2. Chemical evidence — Look for 'isoamyl acetate' or '3-methylbutyl ethanoate' on the ingredient list. Natural banana extract would list 'banana fruit extract' or similar. Synthetic versions are often labeled as 'flavouring' or 'aroma compound'.
  3. School lab test — Perform a simple esterification test: react an alcohol with a carboxylic acid in presence of concentrated sulfuric acid catalyst. If the banana scent appears, it confirms ester formation. Compare with authentic samples.
  4. Economic benefit — Local production creates jobs in Sierra Leone, reduces import costs (no foreign exchange spent on importing extracts), and supports local chemical industry development near Fourah Bay College or industrial areas like Wellington Industrial Estate.

→ Synthetic isoamyl acetate is cheaper, more consistent, and locally producible. Look for 'isoamyl acetate' on labels. Test via simple esterification reaction. Local production saves foreign exchange and creates jobs.

Grading rubric

Clear explanation of synthetic vs natural advantages1 pts
Identification of expected chemical evidence on label1 pts
Description of feasible school lab test1 pts
Local economic benefit analysis2 pts

Exercice 5: Production Scenario - Bo District (6 points)

Chemical industry calculationsCost analysisStoichiometry in context

A small-scale chemical producer in Bo wants to make banana-scented ester for sachets sold at 5,000 Leones each. They can buy isoamyl alcohol at 25,000 Leones per 500 mL bottle and acetic acid at 12,000 Leones per 500 mL. Each sachet requires 0.5 g of ester. Calculate the profit per sachet if they produce 1,000 sachets using the theoretical yield from Exercice 3.

  • Price of isoamyl alcohol = 25,000 Leones / 500 mL
  • Price of acetic acid = 12,000 Leones / 500 mL
  • Sachet price = 5,000 Leones
  • Ester required per sachet = 0.5 g
  • Total sachets = 1,000
  • Theoretical yield from Exercice 3 = 179.4 g
  1. Calculate the cost of isoamyl alcohol needed for 1,000 sachets.
  2. Calculate the cost of acetic acid needed (assume 1:1 mole ratio and acetic acid is limiting at 0.5 L).
  3. Calculate total production cost for 1,000 sachets.
  4. Calculate total revenue from selling 1,000 sachets.
  5. Calculate profit per sachet in Leones.
Full solution
  1. Alcohol cost calculation — From Exercice 3, we used 150 mL alcohol for theoretical yield. For 1,000 sachets requiring 500 g total ester (1,000 × 0.5 g). Scale factor = 500/179.4 = 2.79. Alcohol needed = 150 mL × 2.79 = 418.5 mL. Cost = (25,000/500) × 418.5 = 20,925 Leones.
    Valcohol=150 mL×500 g179.4 g=418.5 mLCalcohol=25,000500×418.5=20,925 Leones
  2. Acetic acid cost — Acetic acid price per mL = 12,000/500 = 24 Leones/mL. Assuming same volume needed as alcohol (1:1 mole ratio, similar density), cost = 418.5 × 24 = 10,044 Leones.
    Cacid=418.5 mL×24 Leones/mL=10,044 Leones
  3. Total production cost — Sum of alcohol and acid costs.
    Ctotal=20,925+10,044=30,969 Leones
  4. Total revenue — 1,000 sachets × 5,000 Leones each.
    R=1,000×5,000=5,000,000 Leones
  5. Profit per sachet — Total profit divided by number of sachets. Profit = Revenue - Cost = 5,000,000 - 30,969 = 4,969,031 Leones. Per sachet = 4,969,031 / 1,000 = 4,969 Leones.
    Psachet=5,000,00030,9691,000=4,969 Leones

4,969 Leones

→ Profit per sachet is 4,969 Leones. Total profit for 1,000 sachets is 4,969,031 Leones.

Grading rubric

Correct scaling of alcohol volume for 1,000 sachets1 pts
Correct cost calculation for alcohol1 pts
Correct cost calculation for acetic acid1 pts
Correct total cost and revenue calculations1 pts
Correct profit per sachet calculation2 pts

Exercice 6: Structure-Property Relationship (4 points)

Molecular structureSmell chemistryStructure-property relationships

Explain why isoamyl acetate smells like bananas while ethyl butanoate smells like pineapple. Use structural formulas to support your answer.

  • Isoamyl acetate: CH₃COOCH₂CH₂CH(CH₃)₂
  • Ethyl butanoate: CH₃CH₂CH₂COOCH₂CH₃
  1. Draw the structural formula of each ester.
  2. Compare the carbon chain lengths on either side of the ester group.
  3. How does the molecular structure influence the smell detected by olfactory receptors?
Full solution
  1. Structural formulas — Isoamyl acetate has a branched 5-carbon chain attached to oxygen and a 2-carbon chain attached to carbonyl. Ethyl butanoate has a straight 4-carbon chain on acid side and 2-carbon chain on alcohol side.
    Isoamyl acetate: CH3C(=O)OCH2CH2CH(CH3)CH3Ethyl butanoate: CH3CH2CH2C(=O)OCH2CH3
  2. Chain length comparison — Isoamyl acetate has a total of 7 carbons with branching, creating a specific molecular shape. Ethyl butanoate has 6 carbons in a more linear arrangement. The shape determines how the molecule fits into olfactory receptors.
  3. Receptor interaction — Olfactory receptors in your nose have specific shapes. Molecules with shapes matching receptor sites trigger nerve signals interpreted as specific smells. The banana-shaped receptor fits isoamyl acetate better than ethyl butanoate, hence banana scent.

→ Isoamyl acetate's branched structure fits banana receptors; ethyl butanoate's linear structure fits pineapple receptors. Molecular shape determines smell through receptor specificity.

Grading rubric

Correct structural formulas for both esters1 pts
Accurate comparison of carbon chain lengths1 pts
Clear explanation of structure-smell relationship2 pts

Exercice 7: Exam-Style Calculation - Kenema Scenario (5 points)

Titration conceptsConcentration calculationsPractical chemistry

A WASSCE past paper asked: 'A student prepared isoamyl acetate by reacting 0.2 mol of isoamyl alcohol with excess acetic acid. The actual yield was 18 g. Calculate the percentage yield.' Solve this problem using appropriate steps.

  • Moles of isoamyl alcohol = 0.2 mol
  • Molar mass of isoamyl acetate = 130 g/mol
  • Actual yield = 18 g
  1. Calculate the theoretical yield in grams.
  2. Write the formula for percentage yield.
  3. Calculate the percentage yield of the reaction.
Full solution
  1. Theoretical yield — From stoichiometry, 0.2 mol alcohol produces 0.2 mol ester. Mass = moles × molar mass.
    mtheoretical=0.2 mol×130 g/mol=26 g
  2. Percentage yield formula — Percentage yield = (actual yield / theoretical yield) × 100%.
    Percentage yield=actual yieldtheoretical yield×100%
  3. Calculate percentage — Substitute values into the formula.
    Percentage yield=1826×100%=69.23%

69.2\%

→ The percentage yield is 69.2%.

Grading rubric

Correct theoretical yield calculation1 pts
Correct percentage yield formula1 pts
Correct percentage yield calculation with proper rounding2 pts
Proper units and significant figures1 pts

Exercice 8: Critical Thinking - Makeni Market (5 points)

Analysis of claimsScientific literacyConsumer awareness

A Makeni market trader advertises '100% natural banana extract perfume' but the price is suspiciously low. As a chemistry-aware consumer, evaluate this claim. What questions would you ask the seller, and what chemical evidence would you look for to verify the claim?

  1. Why might a '100% natural' claim be suspicious for a banana-scented product?
  2. What specific chemical tests could you perform (if you had lab access) to verify the claim?
  3. What practical tests could you do at home or market to check authenticity?
  4. What local consumer protection advice would you give to buyers?
Full solution
  1. Suspicion reasons — Natural banana extract would require large quantities of bananas, be expensive to produce, and have variable composition. A low price suggests synthetic production which is cheaper and more consistent. Also, '100% natural' is often used as a marketing term without strict regulation.
  2. Lab tests — Perform gas chromatography to identify specific ester compounds. Natural extracts contain many compounds while synthetic isoamyl acetate is pure. Test for presence of other banana volatiles like amyl alcohol.
  3. Practical tests — Compare smell intensity over time - synthetic esters last longer. Check for oily residue (natural extracts may leave more residue). Perform simple solubility test - esters are less soluble in water than natural extracts might be.
  4. Consumer advice — Ask for ingredient lists, request certificates of analysis, compare prices with known synthetic products, and be wary of exaggerated 'natural' claims without proof. Support local industries but demand transparency.

→ The '100% natural' claim is suspicious due to cost and consistency issues. Verify via chemical analysis for pure isoamyl acetate. Practical tests include smell longevity and solubility. Advise buyers to demand ingredient lists and certificates.

Grading rubric

Valid reasons for suspicion of '100% natural' claim1 pts
Description of at least one feasible lab test1 pts
Description of practical market test1 pts
Relevant consumer protection advice2 pts

Sources

  1. en.wikipedia.org
  2. goldbook.iupac.org
  3. doi.org
  4. pubchem.ncbi.nlm.nih.gov
  5. ui.adsabs.harvard.edu
  6. pubmed.ncbi.nlm.nih.gov
  7. www.orgsyn.org
  8. search.worldcat.org
  9. api.semanticscholar.org
  10. arquivo.pt
  11. www.cem.msu.edu
  12. books.google.com
  13. www.chemspider.com
  14. pharmaxchange.info
  15. jlc.jst.go.jp